Bifonazole Impurity D
Bifonazole Impurity D showcases its presence as an impurity prominently within Bifonazole. With remarkable antifungal properties, Bifonazole effectively tackles a diverse range of fungal infections, encompassing both the intricacies of dermatomycoses and the complexities of vulvovaginal candidiasis.
| Supplier | BOC Sciences |
|---|---|
| Product # | 66600-13-3 |
| Pricing | Inquire |
| Cas | 66600-13-3 |
| Molecular Weight | 589.18 |
| Molecular Formula | C41H33N2Cl |
| Canonical SMILES | C1=CC=C(C=C1)C2=CC=C(C=C2)C(C3=CC=CC=C3)N4C=C[N+](=C4)C(C5=CC=CC=C5)C6=CC=C(C=C6)C7=CC=CC=C7.[Cl-] |