Phytic acid solution
| Supplier | CD Formulation |
|---|---|
| Product # | CDC10-0112 |
| Pricing | 250 mL in glass bottle, Inquire for price |
| product1 | Cosmetic Ingredients |
| Molecular Formula | C6H18O24P6 |
| Synonyms | myo-Inositol hexakis(dihydrogen phosphate) |
| CAS Number | 83-86-3 |
| Category | Cosmetic Chelating Chemicals |
| Purity | 50 % (w/w) in H2O |
| Quality Level | 200.0 |
| Storage | 2-8°C |
| Boiling Point | 105 °C |
| Melting Point | <25℃ |
| Density | 1.432 g/mL at 25 °C |
| Product Description | Phytic acid is a mineral chelator that can bind to minerals to form mineral-phytate complex.It can also complex with metal ions bound to the surface of magnesium alloy to form a conversion coating, which can improve the resistance of magnesium alloy towards corrosion. |
| Molecular Weight (g/mol) | 660.04 |
| MDL number | MFCD00082309 |
| Refractive Index | n20/D 1.4 |
| InChI Key | IMQLKJBTEOYOSI-GPIVLXJGSA-N |
| SMILES | OP(O)(=O)O[C@@H]1[C@H](OP(O)(O)=O)[C@H](OP(O)(O)=O)[C@@H](OP(O)(O)=O)[C@H](OP(O)(O)=O)[C@H]1OP(O)(O)=O |
| InChI | 1S/C6H18O24P6/c7-31(8,9)25-1-2(26-32(10,11)12)4(28-34(16,17)18)6(30-36(22,23)24)5(29-35(19,20)21)3(1)27-33(13,14)15/h1-6H,(H2,7,8,9)(H2,10,11,12)(H2,13,14,15)(H2,16,17,18)(H2,19,20,21)(H2,22,23,24)/t1-,2-,3-,4+,5-,6- |
| Stability | Stable. Incompatible with strong oxidizing agents. |
| Hazard Codes | Xi,C |
| Safety Statements | 26-36-37/39-45-36/37/39 |
| WGK Germany | - |
| RTECS | NM7525000 |
| HS Code | 29199000.0 |
| Water Solubility | Miscible |
| Image | 83-86-3 |