2-Benzyloxyethyl Phosphate Dibenzyl Ester
2-Benzyloxyethyl Phosphate Dibenzyl Ester is one of Fosfomycin intermediates. Fosfomycin is an antibiotic that exerts a broad spectrum of antibacterial activity. It was produced by certain Streptomyces species.
| Supplier | BOC Sciences |
|---|---|
| Product # | 1798042-79-1 |
| Pricing | Inquire |
| Cas | 1798042-79-1 |
| Molecular Weight | 412.41 |
| Molecular Formula | C23H25O5P |
| Canonical SMILES | C1=CC=C(C=C1)COCCOP(=O)(OCC2=CC=CC=C2)OCC3=CC=CC=C3 |