44-HomooIigomycin B
44-HomooIigomycin B is an antitumor antibiotic produced by Streptomyces bottropensis. It has activity against fungi such as Aspergillus, Penicillium and Fusarium, but not against yeast and bacteria. It has moderate anti-tumor activity against Colon 26 in vivo.
| Supplier | BOC Sciences |
|---|---|
| Product # | BBF-00971 |
| Pricing | Inquire |
| Cas | 125616-18-4 |
| Molecular Weight | 819.07 |
| Molecular Formula | C46H74O12 |
| Canonical SMILES | CCC1CCC2C(C(C(C3(O2)C(=O)CC(C(O3)CC(C)O)C)CC)OC(=O)C=CC(C(C(C(=O)C(C(C(C(=O)C(C(C(CC=CC=C1)C)O)(C)O)C)O)C)C)O)C)C |