5'-O-(4-Cyanobenzyl)-2',3'-di-O-isopropylideneadenosine
5'-O-(4-Cyanobenzyl)-2',3'-di-O-isopropylideneadenosine, a remarkably powerful adenosine analog extensively utilized in the field of biomedicine, boasts its exceptional efficacy against multiple strains of the hepatitis C virus. This compound, renowned for its remarkable antiviral properties, serves as an indispensable research instrument facilitating the unravelling of the intricate mechanisms of viral replication.
| Supplier | BOC Sciences |
|---|---|
| Product # | 1134156-51-6 |
| Pricing | Inquire |
| Cas | 1134156-51-6 |
| Molecular Weight | 422.44 |
| Molecular Formula | C21H22N6O4 |
| Canonical SMILES | CC1(OC2C(OC(C2O1)N3C=NC4=C(N=CN=C43)N)COCC5=CC=C(C=C5)C#N)C |