N-Acetylneuraminic acid sodium salt
N-Acetylneuraminic acid sodium salt is an indispensable and pivotal compound extensively employed in the biomedical industry. With crucial role as an indispensable substrate, it serves as a fundamental building block for the development and synthesis of sialic acid-based drugs.
| Supplier | BOC Sciences |
|---|---|
| Product # | 126934-33-6 |
| Pricing | Inquire |
| Cas | 126934-33-6 |
| Molecular Weight | 331.25 |
| Molecular Formula | C11H18NNaO9 |
| Canonical SMILES | CC(=O)NC(C(CC(=O)C(=O)[O-])O)C(C(C(CO)O)O)O.[Na+] |