L-Phenylalanine 7-amido-4-methylcoumarin trifluoroacetate salt
L-Phenylalanine 7-Amido-4-methylcoumarin, Trifluoroacetate Salt is a fluorogenic substrate for phenylalanine peptidase yielding a blue fluorescent solution from cleavage. L-Phenylalanine 7-Amido-4-methylcoumarin, Trifluoroacetate Salt can be used as reactant/reagent for activation of lymphocyte progranzyme by dipeptidyl peptidase I.
| Supplier | BOC Sciences |
|---|---|
| Product # | BAT-007998 |
| Pricing | Inquire |
| Cas | 108321-84-2 |
| Molecular Weight | 436.38 |
| Molecular Formula | C21H19F3N2O5 |
| Canonical SMILES | CC1=CC(=O)OC2=C1C=CC(=C2)NC(=O)C(CC3=CC=CC=C3)N.C(=O)(C(F)(F)F)O |