Cephamycin A
It is produced by the strain of Streptomyces lactamdurans, Str. chartrensis, Str. griseus, Str. cinnamonensis, Str. fimbiiatus, Str. halstddii, Str. rochei, Str. vuridochromogene. Cephalomycin A showed weak activity against gram-positive and negative bacteria.
| Supplier | BOC Sciences |
|---|---|
| Product # | BBF-00512 |
| Pricing | Inquire |
| Cas | 34279-78-2 |
| Molecular Weight | 659.64 |
| Molecular Formula | C25H29N3O14S2 |
| Canonical SMILES | COC(=CC1=CC=C(C=C1)OS(=O)(=O)O)C(=O)OCC2=C(N3C(C(C3=O)(NC(=O)CCCC(C(=O)O)N)OC)SC2)C(=O)O |