Phenylethyl b-D-galactopyranoside
Phenylethyl b-D-galactopyranoside is a cutting-edge compound, serving as a crucial substrate for β-galactosidase. It not only facilitates meticulous detection but also allows for accurate quantification of this remarkable enzyme within the realm of biomedical investigation.
| Supplier | BOC Sciences |
|---|---|
| Product # | 14861-16-6 |
| Pricing | Inquire |
| Cas | 14861-16-6 |
| Molecular Weight | 284.31 |
| Molecular Formula | C14H20O6 |
| Canonical SMILES | C1=CC=C(C=C1)CCOC2C(C(C(C(O2)CO)O)O)O |