Ethyl 2-acetamido-2-deoxy-b-D-thioglucopyranoside
Ethyl 2-acetamido-2-deoxy-b-D-thioglucopyranoside, a pivotal molecule extensively employed in the biomedical sector, assumes a significant role as a potent instrument for probing the intricate enzymatic mechanisms inherent in glycoproteins and glycolipids. Its multifaceted applications span diverse research domains, notably encompassing the investigation of malignant neoplasms and debilitating neurodegenerative conditions.
| Supplier | BOC Sciences |
|---|---|
| Product # | 122331-70-8 |
| Pricing | Inquire |
| Cas | 122331-70-8 |
| Molecular Weight | 265.33 |
| Molecular Formula | C10H19NO5S |
| Canonical SMILES | CCSC1C(C(C(C(O1)CO)O)O)NC(=O)C |