2-(3,4-Epoxycyclohexyl)ethyltrimethoxysilane
2-(3,4-Epoxycyclohexyl)ethyltrimethoxysilane is a silane coupling agent used in biomedical research for the manufacture of drug delivery systems. It aids in creating stable, covalent bonds between organic and inorganic substances to optimize pharmaceutical properties.
| Supplier | BOC Sciences |
|---|---|
| Product # | 3388-04-3 |
| Pricing | Inquire |
| Cas | 3388-04-3 |
| Molecular Weight | 246.38 |
| Molecular Formula | C11H22O4Si |
| Canonical SMILES | CO[Si](CCC1CCC2OC2C1)(OC)OC |