S4-(2-Cyanoethyl)-5'-O-(dimethoxytrityl)-4-thiothymidine
S4-(2-Cyanoethyl)-5'-O-(dimethoxytrityl)-4-thiothymidine is a potent biomedical compound used in the research of virus diseases like HIV and herpes simplex virus. This compound acts as a thio-substituted thymidine analogue, inhibiting viral replication and promoting host immune response.
| Supplier | BOC Sciences |
|---|---|
| Product # | 142409-74-3 |
| Pricing | Inquire |
| Cas | 142409-74-3 |
| Molecular Weight | 613.74 |
| Molecular Formula | C34H35N3O6S |
| Canonical SMILES | CC1=CN(C(=O)N=C1SCCC#N)C2CC(C(O2)COC(C3=CC=CC=C3)(C4=CC=C(C=C4)OC)C5=CC=C(C=C5)OC)O |