4-Biphenylyl Sulfate Potassium Salt
4-Biphenylyl Sulfate Potassium Salt is a derivative of 4-Phenylphenol (P336135). 4-Phenylphenol is a reagent used in the synthesis of pyrrolo[1,2-c]imidazole dione derivatives as selective serotonin 5-HT1A receptor agonists with antinociceptive activity.
| Supplier | BOC Sciences |
|---|---|
| Product # | BB073331 |
| Pricing | Inquire |
| Cas | 16063-84-6 |
| Molecular Weight | 288.36 |
| Molecular Formula | C12H9KO4S |
| Canonical SMILES | C1=CC=C(C=C1)C2=CC=C(C=C2)OS(=O)(=O)[O-].[K+] |