Sydowinin B
Sydowinin B is a xanthone polyketide originally isolated from A. sydowii and has immunosuppressant activity. It inhibits LPS- or concanavalin A-induced proliferation of isolated mouse splenic lymphocytes (IC50s = 19.2 and 20.8 µg/ml, respectively).
| Supplier | BOC Sciences |
|---|---|
| Product # | 58450-00-3 |
| Pricing | Inquire |
| Cas | 58450-00-3 |
| Molecular Weight | 316.26 |
| Molecular Formula | C16H12O7 |
| Canonical SMILES | COC(=O)C1=C(C=CC2=C1C(=O)C3=C(C=C(C=C3O2)CO)O)O |