Propyl b-D-glucuronide
Propyl b-D-glucuronide is a researchpharmaceutical drug commonly used in biomedical research acting as a substrate for enzymes involved in glucuronidation and drug metabolism studies. Propyl b-D-glucuronide is utilized to investigate the behavior and kinetics of drugs undergoing glucuronidation reactions, helping to understand drug metabolism pathways and potential drug-drug interactions.
| Supplier | BOC Sciences |
|---|---|
| Product # | 17685-07-3 |
| Pricing | Inquire |
| Cas | 17685-07-3 |
| Molecular Weight | 236.22 |
| Molecular Formula | C9H16O7 |
| Canonical SMILES | CCCOC1C(C(C(C(O1)C(=O)O)O)O)O |