Losartan Related Compound B
Des[2'-(1H-tetrazol-5-yl)] 2-Cyanolosartan is a derivative of Losartan Potassium, an angiotensin II antagonist and is commonly used to significantly reduce risk of new onset atrial fibrillation and associated stroke in high-risk patients.
Supplier | BOC Sciences |
---|---|
Product # | 114772-55-3 |
Pricing | Inquire |
Cas | 114772-55-3 |
Molecular Weight | 379.88 |
Molecular Formula | C22H22ClN3O |
Canonical SMILES | CCCCC1=NC(=C(N1CC2=CC=C(C=C2)C3=CC=CC=C3C#N)CO)Cl |