4'-Nitrobenzoyl-6-selenoinosine
4'-Nitrobenzoyl-6-selenoinosine is a drug used for biomedical research in the treatment of certain types of cancer and viral infections. It is a derivative of inosine with a nitrobenzoyl group attached to carbon 4 and a selenium atom replacing the oxygen at position 6. Its chemical properties make it a potential antitumor and antiviral agent, but further studies are needed to fully understand its mechanism of action.
| Supplier | BOC Sciences |
|---|---|
| Product # | 40144-12-5 |
| Pricing | Inquire |
| Cas | 40144-12-5 |
| Molecular Weight | 466.31 |
| Molecular Formula | C17H17N5O6Se |
| Canonical SMILES | C1=CC(=CC=C1C[Se]C2=NC=NC3=C2N=CN3C4C(C(C(O4)CO)O)O)[N+](=O)[O-] |