RFRP-1 (human)
RFRP-1 (human), a mammalian ortholog of avian gonadotropin inhibitory hormone (GnIH), is a potent endogenous NPFF receptor agonist (EC50 values are 0.0011 and 29 nM for NPFF2 and NPFF1, respectively). RFRP-1 exhibits anorexigenic, anti-fertility, and anxiogenic activities. RFRP-1-secreting neurons are stress activated and inhibit the secretion of gonadotropin and gonadotropin-releasing hormone (GnRH). In vivo, this peptide inhibits reproductive behavior, decreases food intake, and increases anxiety behavior in an oxytocin-mediated manner.
| Supplier | BOC Sciences |
|---|---|
| Product # | 311309-25-8 |
| Pricing | Inquire |
| Cas | 311309-25-8 |
| Molecular Weight | 1428.72 |
| Molecular Formula | C67H101N19O14S |
| Canonical SMILES | CC(C)CC(C(=O)NC(CCCN=C(N)N)C(=O)NC(CC1=CC=CC=C1)C(=O)N)NC(=O)C2CCCN2C(=O)C(CC(C)C)NC(=O)C(CC(=O)N)NC(=O)C(C)NC(=O)C(CC3=CC=CC=C3)NC(=O)C(CO)NC(=O)C(CC4=CN=CN4)NC(=O)C5CCCN5C(=O)C(CCSC)N |