2-(9-Oxoxanthen-2-yl)propionic Acid 1,5-Diazabicyclo[4.3.0]non-5-ene Salt
2-(9-Oxoxanthen-2-yl)propionic Acid 1,5-Diazabicyclo[4.3.0]non-5-ene Salt is an efficacious biochemical agent, is an instrumental tool utilized within the realm of biomedical inquiry. It can be used to probe cellular control structures associated with specific neurodegenerative and cardiovascular diseases.
| Supplier | BOC Sciences |
|---|---|
| Product # | 1346753-04-5 |
| Pricing | Inquire |
| Cas | 1346753-04-5 |
| Molecular Weight | 392.46 |
| Molecular Formula | C23H24N2O4 |
| Canonical SMILES | CC(C1=CC2=C(C=C1)OC3=CC=CC=C3C2=O)C(=O)O.C1CC2=NCCCN2C1 |