CR-1-31-B
CR-1-31-B is a potent eIF4A RNA helicase inhibitor. CR-1-31-B exhibits powerful inhibitory effects over eIF4A by perturbing the interaction between eIF4A and RNA, sequentially impeding initiation during protein synthesis. CR-1-31-B induces apoptosis of neuroblastoma and gallbladder cancer cells.
Supplier | BOC Sciences |
---|---|
Product # | 1352914-52-3 |
Pricing | Inquire |
Cas | 1352914-52-3 |
Molecular Weight | 507.53 |
Molecular Formula | C28H29NO8 |
Canonical SMILES | COC1=CC=C(C=C1)C23C(C(C(C2(C4=C(O3)C=C(C=C4OC)OC)O)O)C(=O)NOC)C5=CC=CC=C5 |