1-Boc-3,5-dimethylpyrazole-4-boronic acid pinacol ester
1-Boc-3,5-dimethylpyrazole-4-boronic acid pinacol ester is a key reagent in biomedical research, specifically in the development of boron-containing drugs. It is frequently used in the synthesis of protein kinase inhibitors, which may be used in drug development for cancer treatments.
| Supplier | BOC Sciences |
|---|---|
| Product # | 1073354-70-7 |
| Pricing | Inquire |
| Cas | 1073354-70-7 |
| Molecular Weight | 322.21 |
| Molecular Formula | C16H27BN2O4 |
| Canonical SMILES | B1(OC(C(O1)(C)C)(C)C)C2=C(N(N=C2C)C(=O)OC(C)(C)C)C |