2,4,6-Tri-O-acetyl-3-O-benzyl-b-D-glucopyranosylamine
2,4,6-Tri-O-acetyl-3-O-benzyl-b-D-glucopyranosylamine, a chemical compound employed as an intermediary compound in the amalgamation of different glycosylated drugs, can effectively suppress leukemia cells owing to its anti-tumor activities. Given its remarkable properties, 2,4,6-Tri-O-acetyl-3-O-benzyl-b-D-glucopyranosylamine could be regarded as a potential applicant for anti-leukemia therapy.
| Supplier | BOC Sciences |
|---|---|
| Product # | 1025019-40-2 |
| Pricing | Inquire |
| Cas | 1025019-40-2 |
| Molecular Weight | 395.40 |
| Molecular Formula | C19H25NO8 |
| Canonical SMILES | CC(=O)OCC1C(C(C(C(O1)N)OC(=O)C)OCC2=CC=CC=C2)OC(=O)C |