(R)-2-(Trifluoromethylsulfonyloxy)propionic Acid Methyl Ester
(R)-2-(Trifluoromethylsulfonyloxy)propionic acid methyl ester is an intermediate in the synthesis of N-[3-(N-L-Alanyl)-amino-3-carboxypropyl]-D-histidine Trihydrochloride (A510975), which is an analog of Nicotianamine (N408500), a phytosiderophore that is produced in higher plants as iron chelating amino acids that promote uptake of iron from soil.
| Supplier | BOC Sciences |
|---|---|
| Product # | BB057194 |
| Pricing | Inquire |
| Cas | 115724-80-6 |
| Molecular Weight | 236.17 |
| Molecular Formula | C5H7F3O5S |
| Canonical SMILES | CC(C(=O)OC)OS(=O)(=O)C(F)(F)F |