2-Methoxy-1,6-dimethyl-5-vinyl-9,10-dihydrophenanthren-7-ol
2-Methoxy-1,6-dimethyl-5-vinyl-9,10-dihydrophenanthren-7-ol is an exceptionally natural compound extensively employed in studying a myriad of ailments, specifically those associated with hormonal irregularities, such as breast cancer and endometriosis. Its distinctive molecular configuration facilitates precise receptor-based intervention.
| Supplier | BOC Sciences |
|---|---|
| Product # | NP5009 |
| Pricing | Inquire |
| Cas | 2266586-31-4 |
| Molecular Weight | 280.36 |
| Molecular Formula | C19H20O2 |
| Canonical SMILES | CC1=C(C=CC2=C1CCC3=CC(=C(C(=C32)C=C)C)O)OC |