3'-O-Acetylthymidine
3'-O-Acetylthymidine is a widely utilized biomedical compound, exhibiting its prowess in research of specific viral infections and cancer. Serving as a formidable nucleoside analog, it unleashes its latent potential as a potent antiviral and antitumor agent.
| Supplier | BOC Sciences |
|---|---|
| Product # | 21090-30-2 |
| Pricing | Inquire |
| Cas | 21090-30-2 |
| Molecular Weight | 284.27 |
| Molecular Formula | C12H16N2O6 |
| Canonical SMILES | CC1=CN(C(=O)NC1=O)C2CC(C(O2)CO)OC(=O)C |