Drimentine A
It is produced by the strain of Actinomycete strain MST-8651. It belongs to a novel class of antibiotics, possessing a new terpenylated diketopiperazine structure, with antibacterial, antifungal and anthelmintic activity.
| Supplier | BOC Sciences |
|---|---|
| Product # | 204398-90-3 |
| Pricing | Inquire |
| Cas | 204398-90-3 |
| Molecular Weight | 503.72 |
| Molecular Formula | C32H45N3O2 |
| Canonical SMILES | CC(C)CC1C(=O)N2C(CC3(C2NC4=CC=CC=C43)CC5C(=C)CCC6C5(CCCC6(C)C)C)C(=O)N1 |