(2S)-2-Hydrazino-3-(3-hydroxy-4-methoxyphenyl)-2-methylpropanoic Acid
(2S)-2-Hydrazino-3-(3-hydroxy-4-methoxyphenyl)-2-methylpropanoic Acid is derived from L-Alanine Methyl Ester Hydrochloride (A481000), which is a derivative of L-Alanine (A481500). L-Alanine used to make in-vivo measurement of glucose and alanine metabolism in studies of patients with diabetes. L-Alanine is a non-essential amino acid for human development and is one of the 20 amino acids encoded by the genetic code.
| Supplier | BOC Sciences |
|---|---|
| Product # | BB064142 |
| Pricing | Inquire |
| Cas | 1361017-74-4 |
| Molecular Weight | 240.26 |
| Molecular Formula | C11H16N2O4 |
| Canonical SMILES | CC(CC1=CC(=C(C=C1)OC)O)(C(=O)O)NN |