Hel 13-5
Hel 13-5 is a cell-penetrating peptide that contains Leu and Lys residues in the ratio of 13:5. It binds to DNA and forms alpha-helical structures. It is used as an efficient way for gene transfer into cells and DNA transfection.
Supplier | BOC Sciences |
---|---|
Product # | BAT-013332 |
Pricing | Inquire |
Cas | 177942-21-1 |
Molecular Weight | 2202.98 |
Molecular Formula | C113H204N24O19 |
Canonical SMILES | CC(C)CC(C(=O)NC(CC(C)C)C(=O)NC(CCCCN)C(=O)NC(CC(C)C)C(=O)NC(CC(C)C)C(=O)NC(CC(C)C)C(=O)NC(CCCCN)C(=O)NC(CC(C)C)C(=O)NC(CC1=CNC2=CC=CC=C21)C(=O)NC(CC(C)C)C(=O)NC(CCCCN)C(=O)NC(CC(C)C)C(=O)NC(CC(C)C)C(=O)NC(CCCCN)C(=O)NC(CC(C)C)C(=O)NC(CC(C)C)C(=O)NC(CC(C)C)C(=O)O)NC(=O)C(CCCCN)N |