Simvastatin Impurity G
A metabolite of Simvastatin. Simvastatin is a lipid-lowering drug that inhibits HMG-CoA reductase. It is in the statin class of medications and works by decreasing the manufacture of cholesterol by the liver.
| Supplier | BOC Sciences |
|---|---|
| Product # | 121624-18-8 |
| Pricing | Inquire |
| Cas | 121624-18-8 |
| Molecular Weight | 416.56 |
| Molecular Formula | C25H36O5 |
| Canonical SMILES | CCC(C)(C)C(=O)OC1CC(=C)C=C2C1C(C(C=C2)C)CCC3CC(CC(=O)O3)O |