Prednisone Impurity 1
An impurity of Prednisone. Prednisone is a synthetic corticosteroid drug. It can be used for the treatment of certain inflammatory diseases, some autoimmune diseases, and (at higher doses) some types of cancer.
| Supplier | BOC Sciences |
|---|---|
| Product # | B2694-075696 |
| Pricing | Inquire |
| Cas | 7091-05-6 |
| Molecular Weight | 358.44 |
| Molecular Formula | C21H26O5 |
| Canonical SMILES | CC12CC3C4(O3)C(C1CCC2(C(=O)CO)O)CCC5=CC(=O)C=CC45C |