O-(Ethenylsulfonyl)-L-tyrosine
O-(Ethenylsulfonyl)-L-tyrosine is a metabolite of L-Tyrosine (Levodopa EP Impurity B) which is one of the 22 proteinogenic amino acids that are used by cells to synthesize proteins. L-Tyrosine is biologically converted from L-phenylalanine and is in turn is converted to L-DOPA and further converted into the neurotransmitters: dopamine, norepinephrine, and epinephrine.
| Supplier | BOC Sciences |
|---|---|
| Product # | BB066317 |
| Pricing | Inquire |
| Cas | 1213253-84-9 |
| Molecular Weight | 271.29 |
| Molecular Formula | C11H13NO5S |
| Canonical SMILES | C=CS(=O)(=O)OC1=CC=C(C=C1)CC(C(=O)O)N |