Thalidomide-O-amido-PEG4-C2-NH2 hydrochloride
Thalidomide-O-amido-PEG4-C2-NH2 hydrochloride is a synthetic E3 ligand-linker conjugate containing a cereblon ligand based on Thalidomide and a PEG linker of 4 O(CH2)2 units with terminal amine, as a part of a variety of functionalized PROTAC molecules for binding to a target protein ligand.
| Supplier | BOC Sciences |
|---|---|
| Product # | BP-100115 |
| Pricing | Inquire |
| Cas | 2245697-85-0 |
| Molecular Weight | 587.02 |
| Molecular Formula | C₂₅H₃₅ClN₄O₁₀ |
| Canonical SMILES | O=C(C1=C(C(OCC(NCCOCCOCCOCCOCCN)=O)=CC=C1)C2=O)N2C(C(N3)=O)CCC3=O.Cl |