Methyl 4-Cyanobenzo[b]thiophene-2-carboxylate
Methyl 4-Cyanobenzo[b]thiophene-2-carboxylate is an intermediate in the synthesis of Na+/H+ Exchanger Isoform-1 Inhibitor (N379813), a compound which inhibits NHE-1-mediated pH recovery after acidosis, which has been shown to have cardioprotective effects.
| Supplier | BOC Sciences |
|---|---|
| Product # | BB059043 |
| Pricing | Inquire |
| Cas | 861218-72-6 |
| Molecular Weight | 217.24 |
| Molecular Formula | C11H7NO2S |
| Canonical SMILES | COC(=O)C1=CC2=C(C=CC=C2S1)C#N |