Carnosic acid
Carnosic acid is a natural diterpenoid compound isolated from the herb of Rosmarinus officinalis L. Carnosic acid has a protective effect against carcinogens in animal studies and shows antimicrobial and antioxidant activity.
| Supplier | BOC Sciences |
|---|---|
| Product # | NP1546 |
| Pricing | Inquire |
| Cas | 3650-09-7 |
| Molecular Weight | 332.43 |
| Molecular Formula | C20H28O4 |
| Canonical SMILES | O=C(O)C12C=3C(O)=C(O)C(=CC3CCC1C(C)(C)CCC2)C(C)C |