3'-O-Amino-2'-deoxyadenosine 5'-triphosphate
3'-O-Amino-2'-deoxyadenosine 5'-triphosphate is a crucial nucleotide derivative widely utilized in the field of biomedicine. It plays a vital role in various biochemical assays and experiments, particularly in the study of DNA replication, repair, and modification processes. Due to its unique molecular structure, it is frequently employed in research related to drug development, DNA sequencing, and targeted therapies for diseases such as cancer and genetic disorders.
| Supplier | BOC Sciences |
|---|---|
| Product # | 1220515-87-6 |
| Pricing | Inquire |
| Cas | 1220515-87-6 |
| Molecular Weight | 506.20 |
| Molecular Formula | C10H17N6O12P3 |
| Canonical SMILES | C1C(C(OC1N2C=NC3=C(N=CN=C32)N)COP(=O)(O)OP(=O)(O)OP(=O)(O)O)ON |