2-BUTOXY-6-FLUOROPHENYLBORONIC ACID
2-Butoxy-6-fluorophenylboronic acid is biomedical compound that serves as an indispensable element for crafting intricate targeted therapeutic regimens. Its multifarious applications encompass an extensive range, from combating cancer to alleviating inflammatory ailments. This unparalleled amalgamation of attributes seamlessly enhances the efficacy of pharmaceutical interventions while simultaneously curbing detrimental secondary outcomes.
| Supplier | BOC Sciences |
|---|---|
| Product # | 870777-19-8 |
| Pricing | Inquire |
| Cas | 870777-19-8 |
| Molecular Formula | C10H14BFO3 |
| Canonical SMILES | B(C1=C(C=CC=C1F)OCCCC)(O)O |