Kazinol B
Kazinol B is a natural flavonoid found in the barks of Broussonetia papyrife. It has
inhibition of nitric oxide production on LPS-activated macrophages and has inhibiion of SOCE.
inhibition of nitric oxide production on LPS-activated macrophages and has inhibiion of SOCE.
| Supplier | BOC Sciences |
|---|---|
| Product # | NP2014 |
| Pricing | Inquire |
| Cas | 99624-27-8 |
| Molecular Weight | 392.5 |
| Molecular Formula | C25H28O4 |
| Canonical SMILES | CC(=CCC1=C(C=C2C=CC(OC2=C1O)(C)C)C3CCC4=C(O3)C=C(C=C4)O)C |