1,2:3,4-Di-O-isopropylidene-6-O-methacryloyl-a-D-galactopyranose
The 1,2:3,4-Di-O-isopropylidene-6-O-methacryloyl-a-D-galactopyranose compound stands out as an essential element in the synthesis of glycoconjugates. Its application in drug delivery and vaccine development cannot be overstated, given its ability to form multivalent carbohydrate conjugates. Remarkably, the compound boasts inhibitory features on β-galactosidase, a trait instrumental in studying the mechanics of galactosialidosis, a type of lysosomal storage diseases, and understanding the disease's underlying processes.
| Supplier | BOC Sciences |
|---|---|
| Product # | 2715-36-8 |
| Pricing | Inquire |
| Cas | 2715-36-8 |
| Molecular Weight | 328.36 |
| Molecular Formula | C16H24O7 |
| Canonical SMILES | CC(=C)C(=O)OCC1C2C(C3C(O1)OC(O3)(C)C)OC(O2)(C)C |