Cetirizine EP Impurity B
De(carboxymethoxy) Cetirizine Acetic Acid is an impurity of Cetirizine; a nonsedating type histamine H1-receptor antagonist and a major metabolite of Hydroxyzine. Pharmacological activity of Cetirizine resides primarily in the (R)-isomer. Also antihystaminic.
| Supplier | BOC Sciences |
|---|---|
| Product # | 113740-61-7 |
| Pricing | Inquire |
| Cas | 113740-61-7 |
| Molecular Weight | 344.84 |
| Molecular Formula | C19H21ClN2O2 |
| Canonical SMILES | C1CN(CCN1CC(=O)O)C(C2=CC=CC=C2)C3=CC=C(C=C3)Cl |