Amycolatopsin B
Amycolatopsin B is a bacterial metabolite produced by Amycolatopsis that has anticancer activity. It is cytotoxic to NCI H460 lung and SW620 colon cancer cells (IC50s = 0.28 and 0.14 µM, respectively).
| Supplier | BOC Sciences |
|---|---|
| Product # | 2209112-97-8 |
| Pricing | Inquire |
| Cas | 2209112-97-8 |
| Molecular Weight | 1171.40 |
| Molecular Formula | C60H98O22 |
| Canonical SMILES | CC1C=C(C=C(C=C(C(=O)OC(CC(C(C=C(C=C(C=C(C1OC2C(C(C(C(O2)C)OC)O)O)C)C)C)O)OC)C(C)C3(C(C(C(C(O3)CCCOC)(C)OC4CC(C(C(O4)C)OC5CC(C(C(O5)C)O)(C)O)O)O)OC)O)C)OC)C |