4'-C-Methyl-N6-methyladenosine
4'-C-Methyl-N6-methyladenosine is a key compound used in biomedical research for studying RNA methylation. It is a modified adenine nucleoside that mimics a post-transcriptional modification found in RNA molecules. This compound plays a vital role in investigating the effects of RNA methylation on gene expression and various diseases, including cancer, neurodegenerative disorders is and cardiovascular diseases.
| Supplier | BOC Sciences |
|---|---|
| Product # | 1064364-55-1 |
| Pricing | Inquire |
| Cas | 1064364-55-1 |
| Molecular Weight | 295.30 |
| Molecular Formula | C12H17N5O4 |
| Canonical SMILES | CC1(C(C(C(O1)N2C=NC3=C(N=CN=C32)NC)O)O)CO |