A-1331852
A-1331852, a substituted benzothiazole, is a high affinity BH3 mimetic Ligand of BCL protein BCL-XL (Ki≤ 10 pM). A-1331852 is an orally apoptosis-inducing agent that may have potential as improved cancer therapeutics.
| Supplier | BOC Sciences |
|---|---|
| Product # | B0084-007703 |
| Pricing | 100 mg/unit USD $1099 |
| Cas | 1430844-80-6 |
| Molecular Weight | 658.81 |
| Molecular Formula | C38H38N6O3S |
| Canonical SMILES | CC1=C(C=NN1CC23CC4CC(C2)CC(C4)C3)C5=C(N=C(C=C5)N6CCC7=CC=CC(=C7C6)C(=O)NC8=NC9=CC=CC=C9S8)C(=O)O |