2,3,6,2,3,4,6-Hepta-O-acetyl-b-lactosyl azide
2,3,6,2,3,4,6-Hepta-O-acetyl-beta-lactosyl azide, a highly intricate and versatile biomedical compound, serves as a pivotal component in the synthesis of glycoconjugates. Widely utilized in cutting-edge drug delivery systems, it plays a crucial role in unraveling the intricacies of carbohydrate chemistry within research applications.
| Supplier | BOC Sciences |
|---|---|
| Product # | 30854-62-7 |
| Pricing | Inquire |
| Cas | 30854-62-7 |
| Molecular Weight | 661.57 |
| Molecular Formula | C26H35N3O17 |
| Canonical SMILES | CC(=O)OCC1C(C(C(C(O1)N=[N+]=[N-])OC(=O)C)OC(=O)C)OC2C(C(C(C(O2)COC(=O)C)OC(=O)C)OC(=O)C)OC(=O)C |