Acetyl-3-(2-naphthyl)-D-alanine
Acetyl-3-(2-naphthyl)-D-alanine was used to study the aromatic binding site of α-chymotrypsin. It was used to design an asymmetric synthesis of a new cylindrically chiral and air-stable ferrocenyldiphosphine and its application to rhodium-catalyzed asymmetric hydrogenation.
| Supplier | BOC Sciences |
|---|---|
| Product # | BAT-007886 |
| Pricing | Inquire |
| Cas | 37440-01-0 |
| Molecular Weight | 257.28 |
| Molecular Formula | C15H15NO3 |
| Canonical SMILES | CC(=O)NC(CC1=CC2=CC=CC=C2C=C1)C(=O)O |