Sulfamethoxazole b-D-glucuronide
Sulfamethoxazole b-D-glucuronide is a metabolite of Sulfamethoxazole, a widely used antimicrobial agent. It is formed by glucuronidation in the liver and is excreted in urine. This compound plays a crucial role in understanding the pharmacokinetics and metabolism of Sulfamethoxazole in humans, contributing to drug efficacy and dosage adjustments during the treatment of bacterial infections.
| Supplier | BOC Sciences |
|---|---|
| Product # | 14365-52-7 |
| Pricing | Inquire |
| Cas | 14365-52-7 |
| Molecular Weight | 429.41 |
| Molecular Formula | C16H19N3O9S |
| Canonical SMILES | CC1=CC(=NO1)N(C2C(C(C(C(O2)C(=O)O)O)O)O)S(=O)(=O)C3=CC=C(C=C3)N |