5-Ethynylcytidine
5-Ethynylcytidine is an eminent biomedical compound, employed as a nucleoside analog. It vigorously impedes viral replication and ushers in the righteous realm of apoptosis within malignant cells. Indeed, its profound efficacy can be attributed to its tenacious interference with nucleic acid research and development and relentless disruption of protein functionality.
| Supplier | BOC Sciences |
|---|---|
| Product # | 65223-78-1 |
| Pricing | Inquire |
| Cas | 65223-78-1 |
| Molecular Weight | 267.24 |
| Molecular Formula | C11H13N3O5 |
| Canonical SMILES | C#CC1=CN(C(=O)N=C1N)C2C(C(C(O2)CO)O)O |