Guanosine 5'-(tetrahydrogen triphosphate) Sodium Salt (>80%)
Guanosine 5'-(tetrahydrogen triphosphate) Trisodium Salt, is the salt form of GTP, which is a substrate for the RNA synthesis during the transcription process or DNA during DNA replication. It is also used as an energy source for protein synthesis and gluconeogenesis.
| Supplier | BOC Sciences |
|---|---|
| Product # | 24905-71-3 |
| Pricing | Inquire |
| Cas | 24905-71-3 |
| Molecular Weight | 523.18 |
| Molecular Formula | C10H16N5O14P3•xNa |
| Canonical SMILES | C1=NC2=C(N1C3C(C(C(O3)COP(=O)(O)OP(=O)(O)OP(=O)(O)O)[O-])O)N=C(NC2=O)N.[Na+] |