Tacrolimus EP Impurity C
Tacrolimus EP Impurity C is an impurity of Tacrolimus, which is a calcineurin inhibitor used as an immunosuppressant after organ transplantation to reduce the activity of the patient's immune system, thereby reducing the risk of organ rejection.
| Supplier | BOC Sciences |
|---|---|
| Product # | BBF-05742 |
| Pricing | Inquire |
| Molecular Weight | 789.99 |
| Molecular Formula | C43H67NO12 |
| Canonical SMILES | CC1CC=CC(C(=O)CC(C(C(OC(=O)C2CCCCN2C(=O)C(=O)C3(C(CC(C(O3)C(C1)OC)OC)C)O)C(=CC4CCC(C(C4)OC)O)C)C)O)CC=C |