Coenzyme Q10
| Supplier | CD Formulation |
|---|---|
| Product # | CDC10-0087 |
| CAS # | 206-147-9 |
| Pricing | 100, 500 mg in poly bottle, Inquire for price |
| product1 | Cosmetic Ingredients |
| Molecular Formula | C59H90O4 |
| Synonyms | Q-10, Ubiquinone 50, Ubiquinone-10 |
| CAS Number | 303-98-0 |
| Category | Antioxidant Cosmetic Chemicals |
| Purity | ≥98% (HPLC) |
| Color | Yellow to dark orange |
| Physical State | Powder |
| Solubility | Soluble in chloroform. |
| Quality Level | 200.0 |
| Storage | −20°C |
| Application | cell analysis |
| Boiling Point | 715.32°C (rough estimate) |
| Melting Point | 49 °C |
| Density | 0.9145 g/mL(rough estimate) |
| Molecular Weight (g/mol) | 863.34 |
| MDL number | MFCD00042919 |
| NACRES | NA.77 |
| Refractive Index | 1.4760 (estimate) |
| InChI Key | ACTIUHUUMQJHFO-UPTCCGCDSA-N |
| SMILES | O=C(C(OC)=C1OC)C(C/C=C(C)/CC/C=C(CC/C=C(CC/C=C(CC/C=C(CC/C=C(CC/C=C(C)/CC/C=C(C)/CC/C=C(C)/CCC=C(C)C)\C)\C)\C)\C)\C)=C(C)C1=O |
| InChI | 1S/C59H90O4/c1-44(2)24-15-25-45(3)26-16-27-46(4)28-17-29-47(5)30-18-31-48(6)32-19-33-49(7)34-20-35-50(8)36-21-37-51(9)38-22-39-52(10)40-23-41-53(11)42-43-55-54(12)56(60)58(62-13)59(63-14)57(55)61/h24,26,28,30,32,34,36,38,40,42H,15-23,25,27,29,31,33,35,37,39,41,43H2,1-14H3/b45-26+,46-28+,47-30+,48-32+,49-34+,50-36+,51-38+,52-40+,53-42+ |
| Stability | Stable, but may be light or heat sensitive. Store in the dark at -20 C. Incompatible with strong oxidizing agents. |
| Hazard Codes | Xi |
| Safety Statements | 22-24/25-26 |
| WGK Germany | 3.0 |
| RTECS | DK3900000 |
| Image | 303-98-0 |