Concanamycin B
It is produced by the strain of Streptomyces diastatochromogenes. It has antifungal, antiviral, immunosuppressive, cytotoxic and other activities, and is a specific inhibitor of V-type ATPase, which is an important tool for biochemical research.
| Supplier | BOC Sciences |
|---|---|
| Product # | 81552-33-2 |
| Pricing | Inquire |
| Cas | 81552-33-2 |
| Molecular Weight | 852.06 |
| Molecular Formula | C45H73NO14 |
| Canonical SMILES | CC=CC1C(C(CC(O1)(C(C)C(C(C)C2C(C=CC=C(CC(C(C(C(C(C=C(C=C(C(=O)O2)OC)C)C)O)C)O)C)C)OC)O)O)OC3CC(C(C(O3)C)OC(=O)N)O)C |